What is the [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid?

[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is , while it's Molecular Formula is C6H12N2O3. Used in Pharmaceutical Research and Development: [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is utilized as a building block in the pharmaceutical industry for the development of new drugs and therapeutic agents. Its unique structure and properties make it a promising candidate for the creation of novel compounds with potential medicinal applications. Used in Biochemical Studies: In the field of biochemistry, [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is employed as a subject of study to explore its potential biological activities and interactions with other molecules. This research can lead to a better understanding of its role in biological systems and the discovery of new applications in medicine and other related fields. Used in Drug Design and Synthesis: [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is used as a key component in drug design and synthesis processes. Its incorporation into new molecular structures can enhance the efficacy and selectivity of drugs, potentially leading to the development of more effective treatments for various diseases and conditions. Used in Chemical Synthesis for Diverse Applications: Beyond the pharmaceutical and biochemical fields, [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid can be utilized in chemical synthesis for a variety of applications. Its unique structure allows for the creation of new compounds that can be applied in industries such as materials science, agriculture, and environmental science, among others.

What is the CAS number for [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid?

The CAS number of [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is 49669-74-1.

What is the [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid?

[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is , while it's Molecular Formula is C6H12N2O3. Used in Pharmaceutical Research and Development: [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is utilized as a building block in the pharmaceutical industry for the development of new drugs and therapeutic agents. Its unique structure and properties make it a promising candidate for the creation of novel compounds with potential medicinal applications. Used in Biochemical Studies: In the field of biochemistry, [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is employed as a subject of study to explore its potential biological activities and interactions with other molecules. This research can lead to a better understanding of its role in biological systems and the discovery of new applications in medicine and other related fields. Used in Drug Design and Synthesis: [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is used as a key component in drug design and synthesis processes. Its incorporation into new molecular structures can enhance the efficacy and selectivity of drugs, potentially leading to the development of more effective treatments for various diseases and conditions. Used in Chemical Synthesis for Diverse Applications: Beyond the pharmaceutical and biochemical fields, [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid can be utilized in chemical synthesis for a variety of applications. Its unique structure allows for the creation of new compounds that can be applied in industries such as materials science, agriculture, and environmental science, among others.

What is the CAS number for [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid?

The CAS number of [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is 49669-74-1.

Product classification

Contact us

Tel：+86-0533-2185556
Fax：+86-0533-2185556
Phone：+86 15965530500
Website：http://www.shandonghangyu.com/
Email：admin@hangyubiotech.com
Address：Room 2516, Dingcheng Building, Beijing Road, Zhangdian District, Zibo City, Shandong Province

49669-74-1

Q: What is [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid (49669-74-1) used for?

[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is a unique chemical compound that features an amino acid with a distinctive structure. It is composed of an amino group, a butenoic acid group, and an ethoxy group, which collectively contribute to its versatility and potential applications across various domains. This molecule has garnered significant interest in the realms of biochemistry and pharmaceutical research, primarily due to its capacity to act as a foundational component in the creation of innovative drugs and therapeutic agents. The specific characteristics and potential biological activities of [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid render it a subject worthy of further investigation and study.InChI:InChI=1/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1

Product Name:[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid
Molecular Formula:C₆H₁₂N₂O₃
Molecular Weight:160.1711

Inquiry

Product Details

Purity:99%

99% Purity Commercial production [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid 49669-74-1 with Cheapest Price

Molecular Formula:C6H12N2O3
Molecular Weight:160.1711
Vapor Pressure:2.8E-06mmHg at 25°C
Boiling Point:363.7°Cat760mmHg
PKA:1.50±0.10(Predicted)
Flash Point:173.7°C
PSA：98.57000
Density:1.232g/cm³
LogP:0.28790

[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid(Cas 49669-74-1) Usage

General Description

[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is a chemical compound consisting of an amino acid with a unique structure. It contains an amino group, a butenoic acid group, and an ethoxy group, making it a versatile molecule with potential applications in various fields. [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid has been of interest in the fields of biochemistry and pharmaceutical research due to its potential to serve as a building block for the development of new drugs and therapeutic agents. Its specific properties and potential biological activities make it a target for further exploration and study.

InChI:InChI=1/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1

Relevant Products

JORO SPIDER TOXIN JSTX-3
CAS：112163-33-4
cis-13-Docosenoamide
CAS：112-84-5
3-Bromocumene
CAS：5433-01-2」
SINENSETIN
CAS：2306-27-6

Home

About us

Products

small-molecule inhibitor

intermediate

Pharmaceutical intermediate

Biochemical reagent

fire retardant

chemical reagent

ionic liquid

API

Pharmaceutical intermediates

Biological products

Polypeptides

Chemical reagents

Small molecule inhibitors

Organic electronic chemical materials

Technical Support

News

Contact Us