What is the 2,1,3-Benzoxadiazol-4-amine?

2,1,3-Benzoxadiazol-4-amine is , while it's Molecular Formula is C6H5N3O. Used in Pharmaceutical and Medical Research: 2,1,3-Benzoxadiazol-4-amine is utilized as a pharmaceutical intermediate for its demonstrated biological activities and potential therapeutic properties. Its presence in drug development is attributed to its ability to modulate various biological pathways, making it a candidate for the treatment of several diseases. Used in Materials Science: In the realm of materials science, 2,1,3-Benzoxadiazol-4-amine is employed as a key component in the development of organic semiconductors. Its unique structure allows it to contribute to the advancement of light-emitting materials for optoelectronic devices, showcasing its versatility beyond the medical field. Used in Optoelectronic Devices: 2,1,3-Benzoxadiazol-4-amine is used as a component in the creation of light-emitting diodes (LEDs) and other optoelectronic devices due to its light-emitting properties. Its integration into these technologies is for enhancing performance and exploring new avenues in display and lighting solutions. The multifaceted nature of 2,1,3-Benzoxadiazol-4-amine positions it as a valuable compound for continued research and development across different industries, with the potential to yield innovative solutions in medicine, materials science, and optoelectronics.

What is the CAS number for 2,1,3-Benzoxadiazol-4-amine?

The CAS number of 2,1,3-Benzoxadiazol-4-amine is 767-63-5.

What is 2,1,3-Benzoxadiazol-4-amine (767-63-5) used for?

2,1,3-Benzoxadiazol-4-amine is a chemical compound that belongs to the family of benzoxadiazole derivatives. It is a type of amine characterized by a benzoxadiazole ring structure, which endows it with unique chemical and biological properties. 2,1,3-Benzoxadiazol-4-amine has garnered interest in various fields due to its potential applications and the diverse activities it exhibits.InChI:InChI=1/C6H5N3O/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H,7H2

What is the 2,1,3-Benzoxadiazol-4-amine?

2,1,3-Benzoxadiazol-4-amine is , while it's Molecular Formula is C6H5N3O. Used in Pharmaceutical and Medical Research: 2,1,3-Benzoxadiazol-4-amine is utilized as a pharmaceutical intermediate for its demonstrated biological activities and potential therapeutic properties. Its presence in drug development is attributed to its ability to modulate various biological pathways, making it a candidate for the treatment of several diseases. Used in Materials Science: In the realm of materials science, 2,1,3-Benzoxadiazol-4-amine is employed as a key component in the development of organic semiconductors. Its unique structure allows it to contribute to the advancement of light-emitting materials for optoelectronic devices, showcasing its versatility beyond the medical field. Used in Optoelectronic Devices: 2,1,3-Benzoxadiazol-4-amine is used as a component in the creation of light-emitting diodes (LEDs) and other optoelectronic devices due to its light-emitting properties. Its integration into these technologies is for enhancing performance and exploring new avenues in display and lighting solutions. The multifaceted nature of 2,1,3-Benzoxadiazol-4-amine positions it as a valuable compound for continued research and development across different industries, with the potential to yield innovative solutions in medicine, materials science, and optoelectronics.

What is the CAS number for 2,1,3-Benzoxadiazol-4-amine?

The CAS number of 2,1,3-Benzoxadiazol-4-amine is 767-63-5.

What is 2,1,3-Benzoxadiazol-4-amine (767-63-5) used for?

2,1,3-Benzoxadiazol-4-amine is a chemical compound that belongs to the family of benzoxadiazole derivatives. It is a type of amine characterized by a benzoxadiazole ring structure, which endows it with unique chemical and biological properties. 2,1,3-Benzoxadiazol-4-amine has garnered interest in various fields due to its potential applications and the diverse activities it exhibits.InChI:InChI=1/C6H5N3O/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H,7H2

Product classification

Contact us

Tel：+86-0533-2185556
Fax：+86-0533-2185556
Phone：WhatsApp: +86 15965530500
Website：https://www.shandonghangyubiotech.com
Email：admin@hangyubiotech.com
Address：Room 2516, Dingcheng Building, Beijing Road, Zhangdian District, Zibo City, Shandong Province

767-63-5

Product Name:2,1,3-BENZOXADIAZOL-4-AMINE
Molecular Formula:C₆H₅N₃O
Molecular Weight:135.12

Inquiry

Product Details

pd_meltingpoint:109 °C

Purity:99%

Quality Factory Supply 99% Pure 2,1,3-BENZOXADIAZOL-4-AMINE 767-63-5 with Efficient Delivery

Molecular Formula:C6H5N3O
Molecular Weight:135.12
Vapor Pressure:0.00208mmHg at 25°C
Melting Point:109 °C
Refractive Index:1.701
Boiling Point:290.4 °C at 760 mmHg
PKA:0.53±0.10(Predicted)
Flash Point:129.4 °C
PSA：64.94000
Density:1.421 g/cm³
LogP:1.38620

2,1,3-Benzoxadiazol-4-amine(Cas 767-63-5) Usage

General Description

2,1,3-Benzoxadiazol-4-amine is a chemical compound that belongs to the family of benzoxadiazole derivatives. It is a type of amine with a benzoxadiazole ring structure. 2,1,3-Benzoxadiazol-4-amine is used predominantly in the field of medical and pharmaceutical research as it has been shown to exhibit various biological activities and potential therapeutic properties. Additionally, 2,1,3-Benzoxadiazol-4-amine has also been investigated for its potential applications in materials science, particularly in the development of organic semiconductors and light-emitting materials for optoelectronic devices. Its unique chemical structure and diverse properties make 2,1,3-Benzoxadiazol-4-amine a promising candidate for further research and potential industrial applications.

InChI:InChI=1/C6H5N3O/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H,7H2